Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
p-Xylylene dibromide, 97%
CAS: 623-24-5 Molecular Formula: C8H8Br2 Molecular Weight (g/mol): 263.96 MDL Number: MFCD00000182 InChI Key: RBZMSGOBSOCYHR-UHFFFAOYSA-N Synonym: 1,4-bis bromomethyl benzene,p-xylylene dibromide,alpha,alpha'-dibromo-p-xylene,benzene, 1,4-bis bromomethyl,p-xylylene bromide,p-bromomethyl benzene,1,4-dibromomethylbenzene,p-bis bromomethyl benzene,1,4-bis-bromomethyl-benzene,ccris 1775 PubChem CID: 69335 IUPAC Name: 1,4-bis(bromomethyl)benzene SMILES: C1=CC(=CC=C1CBr)CBr
| PubChem CID | 69335 |
|---|---|
| CAS | 623-24-5 |
| Molecular Weight (g/mol) | 263.96 |
| MDL Number | MFCD00000182 |
| SMILES | C1=CC(=CC=C1CBr)CBr |
| Synonym | 1,4-bis bromomethyl benzene,p-xylylene dibromide,alpha,alpha'-dibromo-p-xylene,benzene, 1,4-bis bromomethyl,p-xylylene bromide,p-bromomethyl benzene,1,4-dibromomethylbenzene,p-bis bromomethyl benzene,1,4-bis-bromomethyl-benzene,ccris 1775 |
| IUPAC Name | 1,4-bis(bromomethyl)benzene |
| InChI Key | RBZMSGOBSOCYHR-UHFFFAOYSA-N |
| Molecular Formula | C8H8Br2 |
o-Xylylene dibromide, 97%
CAS: 91-13-4 Molecular Formula: C8H8Br2 Molecular Weight (g/mol): 263.96 MDL Number: MFCD00000175 InChI Key: KGKAYWMGPDWLQZ-UHFFFAOYSA-N Synonym: 1,2-bis bromomethyl benzene,o-xylylene dibromide,alpha,alpha'-dibromo-o-xylene,benzene, 1,2-bis bromomethyl,o-bis bromomethyl benzene,o-xylylene bromide,1,2-dibenzyl bromide,alpha,alpha'-dibromo-o-xylol,a,a'-dibromo-o-xylene,ccris 1776 PubChem CID: 66665 IUPAC Name: 1,2-bis(bromomethyl)benzene SMILES: C1=CC=C(C(=C1)CBr)CBr
| PubChem CID | 66665 |
|---|---|
| CAS | 91-13-4 |
| Molecular Weight (g/mol) | 263.96 |
| MDL Number | MFCD00000175 |
| SMILES | C1=CC=C(C(=C1)CBr)CBr |
| Synonym | 1,2-bis bromomethyl benzene,o-xylylene dibromide,alpha,alpha'-dibromo-o-xylene,benzene, 1,2-bis bromomethyl,o-bis bromomethyl benzene,o-xylylene bromide,1,2-dibenzyl bromide,alpha,alpha'-dibromo-o-xylol,a,a'-dibromo-o-xylene,ccris 1776 |
| IUPAC Name | 1,2-bis(bromomethyl)benzene |
| InChI Key | KGKAYWMGPDWLQZ-UHFFFAOYSA-N |
| Molecular Formula | C8H8Br2 |
Butyl stearate, tech.
CAS: 123-95-5 Molecular Formula: C22H44O2 Molecular Weight (g/mol): 340.59 MDL Number: MFCD00026669 InChI Key: ULBTUVJTXULMLP-UHFFFAOYSA-N Synonym: butyl stearate,n-butyl stearate,octadecanoic acid, butyl ester,kesscoflex bs,n-butyl octadecanoate,stearic acid, butyl ester,butyl octadecylate,kessco bsc,stearic acid n-butyl ester,polycizer 332 PubChem CID: 31278 ChEBI: CHEBI:85983 IUPAC Name: butyl octadecanoate SMILES: CCCCCCCCCCCCCCCCCC(=O)OCCCC
| PubChem CID | 31278 |
|---|---|
| CAS | 123-95-5 |
| Molecular Weight (g/mol) | 340.59 |
| ChEBI | CHEBI:85983 |
| MDL Number | MFCD00026669 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCCCC |
| Synonym | butyl stearate,n-butyl stearate,octadecanoic acid, butyl ester,kesscoflex bs,n-butyl octadecanoate,stearic acid, butyl ester,butyl octadecylate,kessco bsc,stearic acid n-butyl ester,polycizer 332 |
| IUPAC Name | butyl octadecanoate |
| InChI Key | ULBTUVJTXULMLP-UHFFFAOYSA-N |
| Molecular Formula | C22H44O2 |
Oxolinic acid, 98%
CAS: 14698-29-4 Molecular Formula: C13H11NO5 Molecular Weight (g/mol): 261.23 MDL Number: MFCD00056775 InChI Key: KYGZCKSPAKDVKC-UHFFFAOYSA-N Synonym: oxolinic acid,nidantin,dioxacin,emyrenil,prodoxal,prodoxol,ossian,gramurin,oksaren,oxolinic PubChem CID: 4628 ChEBI: CHEBI:138856 IUPAC Name: 5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid SMILES: CCN1C=C(C(O)=O)C(=O)C2=CC3=C(OCO3)C=C12
| PubChem CID | 4628 |
|---|---|
| CAS | 14698-29-4 |
| Molecular Weight (g/mol) | 261.23 |
| ChEBI | CHEBI:138856 |
| MDL Number | MFCD00056775 |
| SMILES | CCN1C=C(C(O)=O)C(=O)C2=CC3=C(OCO3)C=C12 |
| Synonym | oxolinic acid,nidantin,dioxacin,emyrenil,prodoxal,prodoxol,ossian,gramurin,oksaren,oxolinic |
| IUPAC Name | 5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| InChI Key | KYGZCKSPAKDVKC-UHFFFAOYSA-N |
| Molecular Formula | C13H11NO5 |
Thiophene-2-carboxaldehyde, 98+%
CAS: 98-03-3 Molecular Formula: C5H4OS Molecular Weight (g/mol): 112.15 MDL Number: MFCD00005429 InChI Key: CNUDBTRUORMMPA-UHFFFAOYSA-N Synonym: 2-thiophenecarboxaldehyde,2-thenaldehyde,thiophene-2-aldehyde,2-formylthiophene,2-thienylaldehyde,2-thiophenealdehyde,thiophene-2-carboxaldehyde,2-thienylcarboxaldehyde,2-thienaldehyde,alpha-formylthiophene PubChem CID: 7364 ChEBI: CHEBI:87301 IUPAC Name: thiophene-2-carbaldehyde SMILES: O=CC1=CC=CS1
| PubChem CID | 7364 |
|---|---|
| CAS | 98-03-3 |
| Molecular Weight (g/mol) | 112.15 |
| ChEBI | CHEBI:87301 |
| MDL Number | MFCD00005429 |
| SMILES | O=CC1=CC=CS1 |
| Synonym | 2-thiophenecarboxaldehyde,2-thenaldehyde,thiophene-2-aldehyde,2-formylthiophene,2-thienylaldehyde,2-thiophenealdehyde,thiophene-2-carboxaldehyde,2-thienylcarboxaldehyde,2-thienaldehyde,alpha-formylthiophene |
| IUPAC Name | thiophene-2-carbaldehyde |
| InChI Key | CNUDBTRUORMMPA-UHFFFAOYSA-N |
| Molecular Formula | C5H4OS |
Propionitrile, 99%
CAS: 107-12-0 Molecular Formula: C3H5N Molecular Weight (g/mol): 55.08 MDL Number: MFCD00001948 InChI Key: FVSKHRXBFJPNKK-UHFFFAOYSA-N Synonym: propionitrile,ethyl cyanide,propiononitrile,cyanoethane,propylnitrile,propionic nitrile,ether cyanatus,hydrocyanic ether,ethylkyanid,propannitril PubChem CID: 7854 ChEBI: CHEBI:26307 IUPAC Name: propanenitrile SMILES: CCC#N
| PubChem CID | 7854 |
|---|---|
| CAS | 107-12-0 |
| Molecular Weight (g/mol) | 55.08 |
| ChEBI | CHEBI:26307 |
| MDL Number | MFCD00001948 |
| SMILES | CCC#N |
| Synonym | propionitrile,ethyl cyanide,propiononitrile,cyanoethane,propylnitrile,propionic nitrile,ether cyanatus,hydrocyanic ether,ethylkyanid,propannitril |
| IUPAC Name | propanenitrile |
| InChI Key | FVSKHRXBFJPNKK-UHFFFAOYSA-N |
| Molecular Formula | C3H5N |
Phenazine methosulfate, 98+%
CAS: 299-11-6 Molecular Formula: C14H14N2O4S Molecular Weight (g/mol): 306.336 MDL Number: MFCD00011923 InChI Key: RXGJTUSBYWCRBK-UHFFFAOYSA-M Synonym: phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate PubChem CID: 9285 ChEBI: CHEBI:8055 IUPAC Name: 5-methylphenazin-5-ium;methyl sulfate SMILES: C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-]
| PubChem CID | 9285 |
|---|---|
| CAS | 299-11-6 |
| Molecular Weight (g/mol) | 306.336 |
| ChEBI | CHEBI:8055 |
| MDL Number | MFCD00011923 |
| SMILES | C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
| Synonym | phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate |
| IUPAC Name | 5-methylphenazin-5-ium;methyl sulfate |
| InChI Key | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| Molecular Formula | C14H14N2O4S |
2,4,4-Trimethyl-1-pentene, 99%
CAS: 107-39-1 Molecular Formula: C8H16 Molecular Weight (g/mol): 112.216 MDL Number: MFCD00008855 InChI Key: FXNDIJDIPNCZQJ-UHFFFAOYSA-N Synonym: 2,4,4-trimethyl-1-pentene,diisobutylene,pentene, 2,4,4-trimethyl,2,4,4-trimethylpentene,1-pentene, 2,4,4-trimethyl,2,2,4-trimethyl-4-pentene,unii-n69l73advf,1-methyl-1-neopentylethylene,ccris 9103,2,4,4-trimethylpentene-1 PubChem CID: 7868 IUPAC Name: 2,4,4-trimethylpent-1-ene SMILES: CC(=C)CC(C)(C)C
| PubChem CID | 7868 |
|---|---|
| CAS | 107-39-1 |
| Molecular Weight (g/mol) | 112.216 |
| MDL Number | MFCD00008855 |
| SMILES | CC(=C)CC(C)(C)C |
| Synonym | 2,4,4-trimethyl-1-pentene,diisobutylene,pentene, 2,4,4-trimethyl,2,4,4-trimethylpentene,1-pentene, 2,4,4-trimethyl,2,2,4-trimethyl-4-pentene,unii-n69l73advf,1-methyl-1-neopentylethylene,ccris 9103,2,4,4-trimethylpentene-1 |
| IUPAC Name | 2,4,4-trimethylpent-1-ene |
| InChI Key | FXNDIJDIPNCZQJ-UHFFFAOYSA-N |
| Molecular Formula | C8H16 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, dipotassium salt dihydrate, 99%, extra pure
CAS: 25102-12-9 Molecular Formula: C10H14K2N2O8·2H2O Molecular Weight (g/mol): 404.46 MDL Number: MFCD00150036 InChI Key: JFROQFOCFOKDKU-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid dipotassium salt dihydrate,dipotassium dihydrogen ethylenediaminetetraacetate dihydrate,potassium 2,2'-2-bis carboxymethyl amino ethyl azanediyl diacetate dihydrate,edta dipotassium salt dihydrate,edta dipotassium salt,ethylenediaminetetraacetic acid,dipotassium salt dihydrate,potassium ethylenediaminetetraacetate dibasic,dipotassium ethylenediaminetetraacetate dihydrate,ethylenedinitrilo tetraacetic acid dipotassium salt,acmc-209ggx PubChem CID: 53486451 IUPAC Name: dipotassium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[K+].[K+]
| PubChem CID | 53486451 |
|---|---|
| CAS | 25102-12-9 |
| Molecular Weight (g/mol) | 404.46 |
| MDL Number | MFCD00150036 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[K+].[K+] |
| Synonym | ethylenediaminetetraacetic acid dipotassium salt dihydrate,dipotassium dihydrogen ethylenediaminetetraacetate dihydrate,potassium 2,2'-2-bis carboxymethyl amino ethyl azanediyl diacetate dihydrate,edta dipotassium salt dihydrate,edta dipotassium salt,ethylenediaminetetraacetic acid,dipotassium salt dihydrate,potassium ethylenediaminetetraacetate dibasic,dipotassium ethylenediaminetetraacetate dihydrate,ethylenedinitrilo tetraacetic acid dipotassium salt,acmc-209ggx |
| IUPAC Name | dipotassium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | JFROQFOCFOKDKU-UHFFFAOYSA-L |
| Molecular Formula | C10H14K2N2O8·2H2O |
1,2-Propanediol, 99+%, for analysis
CAS: 57-55-6 Molecular Formula: C3H8O2 Molecular Weight (g/mol): 76.09 MDL Number: MFCD00064272 InChI Key: DNIAPMSPPWPWGF-UHFFFAOYSA-N Synonym: 1,2-propanediol,propylene glycol,1,2-dihydroxypropane,2-hydroxypropanol,1,2-propylene glycol,methylethyl glycol,methylethylene glycol,monopropylene glycol,isopropylene glycol,dowfrost PubChem CID: 1030 ChEBI: CHEBI:16997 IUPAC Name: propane-1,2-diol SMILES: CC(CO)O
| PubChem CID | 1030 |
|---|---|
| CAS | 57-55-6 |
| Molecular Weight (g/mol) | 76.09 |
| ChEBI | CHEBI:16997 |
| MDL Number | MFCD00064272 |
| SMILES | CC(CO)O |
| Synonym | 1,2-propanediol,propylene glycol,1,2-dihydroxypropane,2-hydroxypropanol,1,2-propylene glycol,methylethyl glycol,methylethylene glycol,monopropylene glycol,isopropylene glycol,dowfrost |
| IUPAC Name | propane-1,2-diol |
| InChI Key | DNIAPMSPPWPWGF-UHFFFAOYSA-N |
| Molecular Formula | C3H8O2 |
Methylsuccinic acid, 99%
CAS: 498-21-5 Molecular Formula: C5H8O4 Molecular Weight (g/mol): 132.115 MDL Number: MFCD00002659 InChI Key: WXUAQHNMJWJLTG-UHFFFAOYSA-N Synonym: 2-methylsuccinic acid,methylsuccinic acid,pyrotartaric acid,butanedioic acid, methyl,methyl succinic acid,1,2-propanedicarboxylic acid,succinic acid, methyl,2-methyl-butanedioic acid,butanedioic acid, 2-methyl,ccris 6068 PubChem CID: 10349 IUPAC Name: 2-methylbutanedioic acid SMILES: CC(CC(=O)O)C(=O)O
| PubChem CID | 10349 |
|---|---|
| CAS | 498-21-5 |
| Molecular Weight (g/mol) | 132.115 |
| MDL Number | MFCD00002659 |
| SMILES | CC(CC(=O)O)C(=O)O |
| Synonym | 2-methylsuccinic acid,methylsuccinic acid,pyrotartaric acid,butanedioic acid, methyl,methyl succinic acid,1,2-propanedicarboxylic acid,succinic acid, methyl,2-methyl-butanedioic acid,butanedioic acid, 2-methyl,ccris 6068 |
| IUPAC Name | 2-methylbutanedioic acid |
| InChI Key | WXUAQHNMJWJLTG-UHFFFAOYSA-N |
| Molecular Formula | C5H8O4 |
Trimethylamine N-oxide dihydrate, 98+%
CAS: 62637-93-8 Molecular Formula: C3H13NO3 Molecular Weight (g/mol): 111.14 MDL Number: MFCD00149077 InChI Key: PGFPZGKEDZGJQZ-UHFFFAOYSA-N Synonym: trimethylamine-n-oxide dihydrate,trimethylamine n-oxide dihydrate,trimethylamine oxide dihydrate,trimethylamine oxide, dihydrate,n,n-dimethylmethanamine oxide, dihydrate,unii-c73wz0186w,trimethylammoniumoxid hydrat czech,methanamine oxide, n,n-dimethyl, dihydrate,methanamine, n,n-dimethyl-, n-oxide, dihydrate,n,n-dimethylmethanamine oxide dihydrate PubChem CID: 198430 IUPAC Name: N,N-dimethylmethanamine oxide;dihydrate SMILES: O.O.C[N+](C)(C)[O-]
| PubChem CID | 198430 |
|---|---|
| CAS | 62637-93-8 |
| Molecular Weight (g/mol) | 111.14 |
| MDL Number | MFCD00149077 |
| SMILES | O.O.C[N+](C)(C)[O-] |
| Synonym | trimethylamine-n-oxide dihydrate,trimethylamine n-oxide dihydrate,trimethylamine oxide dihydrate,trimethylamine oxide, dihydrate,n,n-dimethylmethanamine oxide, dihydrate,unii-c73wz0186w,trimethylammoniumoxid hydrat czech,methanamine oxide, n,n-dimethyl, dihydrate,methanamine, n,n-dimethyl-, n-oxide, dihydrate,n,n-dimethylmethanamine oxide dihydrate |
| IUPAC Name | N,N-dimethylmethanamine oxide;dihydrate |
| InChI Key | PGFPZGKEDZGJQZ-UHFFFAOYSA-N |
| Molecular Formula | C3H13NO3 |
L-(+)-2-Aminobutyric acid, 98+%
CAS: 1492-24-6 Molecular Formula: C4H9NO2 Molecular Weight (g/mol): 103.121 MDL Number: MFCD00064415 InChI Key: QWCKQJZIFLGMSD-VKHMYHEASA-N Synonym: l-2-aminobutyric acid,s-2-aminobutanoic acid,2s-2-aminobutanoic acid,h-abu-oh,l-alpha-aminobutyric acid,s-+-2-aminobutyric acid,l-+-2-aminobutyric acid,--2-aminobutyric acid,s-2-aminobutyric acid,s-2-amino-butyric acid PubChem CID: 80283 ChEBI: CHEBI:35619 IUPAC Name: (2S)-2-aminobutanoic acid SMILES: CCC(C(=O)O)N
| PubChem CID | 80283 |
|---|---|
| CAS | 1492-24-6 |
| Molecular Weight (g/mol) | 103.121 |
| ChEBI | CHEBI:35619 |
| MDL Number | MFCD00064415 |
| SMILES | CCC(C(=O)O)N |
| Synonym | l-2-aminobutyric acid,s-2-aminobutanoic acid,2s-2-aminobutanoic acid,h-abu-oh,l-alpha-aminobutyric acid,s-+-2-aminobutyric acid,l-+-2-aminobutyric acid,--2-aminobutyric acid,s-2-aminobutyric acid,s-2-amino-butyric acid |
| IUPAC Name | (2S)-2-aminobutanoic acid |
| InChI Key | QWCKQJZIFLGMSD-VKHMYHEASA-N |
| Molecular Formula | C4H9NO2 |
Di-n-butyl phthalate, 99%, Thermo Scientific Chemicals
CAS: 84-74-2 Molecular Formula: C16H22O4 Molecular Weight (g/mol): 278.35 MDL Number: MFCD00009441 InChI Key: DOIRQSBPFJWKBE-UHFFFAOYSA-N Synonym: dibutyl phthalate,di-n-butyl phthalate,n-butyl phthalate,butyl phthalate,celluflex dpb,elaol,genoplast b,palatinol c,polycizer dbp,unimoll db PubChem CID: 3026 ChEBI: CHEBI:34687 IUPAC Name: 1,2-dibutyl benzene-1,2-dicarboxylate SMILES: CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC
| PubChem CID | 3026 |
|---|---|
| CAS | 84-74-2 |
| Molecular Weight (g/mol) | 278.35 |
| ChEBI | CHEBI:34687 |
| MDL Number | MFCD00009441 |
| SMILES | CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC |
| Synonym | dibutyl phthalate,di-n-butyl phthalate,n-butyl phthalate,butyl phthalate,celluflex dpb,elaol,genoplast b,palatinol c,polycizer dbp,unimoll db |
| IUPAC Name | 1,2-dibutyl benzene-1,2-dicarboxylate |
| InChI Key | DOIRQSBPFJWKBE-UHFFFAOYSA-N |
| Molecular Formula | C16H22O4 |
Trichloroacetyl isocyanate, NMR grade
CAS: 3019-71-4 Molecular Formula: C3Cl3NO2 Molecular Weight (g/mol): 188.39 MDL Number: MFCD00002033 InChI Key: GRNOZCCBOFGDCL-UHFFFAOYSA-N Synonym: trichloroacetyl isocyanate,acetyl isocyanate, trichloro,trichloroacetylisocyanate,isocyanic acid trichloroacetyl ester,unii-qxv1p5j6jl,qxv1p5j6jl,acetyl isocyanate, 2,2,2-trichloro,2,2,2-trichloroethanecarbonyl isocyanate,trichloroethanecarbonyl isocyanate,trichloroacetyl isocyanate, nmr grade PubChem CID: 76400 IUPAC Name: 2,2,2-trichloroacetyl isocyanate SMILES: ClC(Cl)(Cl)C(=O)N=C=O
| PubChem CID | 76400 |
|---|---|
| CAS | 3019-71-4 |
| Molecular Weight (g/mol) | 188.39 |
| MDL Number | MFCD00002033 |
| SMILES | ClC(Cl)(Cl)C(=O)N=C=O |
| Synonym | trichloroacetyl isocyanate,acetyl isocyanate, trichloro,trichloroacetylisocyanate,isocyanic acid trichloroacetyl ester,unii-qxv1p5j6jl,qxv1p5j6jl,acetyl isocyanate, 2,2,2-trichloro,2,2,2-trichloroethanecarbonyl isocyanate,trichloroethanecarbonyl isocyanate,trichloroacetyl isocyanate, nmr grade |
| IUPAC Name | 2,2,2-trichloroacetyl isocyanate |
| InChI Key | GRNOZCCBOFGDCL-UHFFFAOYSA-N |
| Molecular Formula | C3Cl3NO2 |